C18H20ClF3N2O2 — CID 120609694
3-(2-aminophenyl)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]propanamide;hydrochloride (PubChem CID 120609694) has the molecular formula C18H20ClF3N2O2 and a molecular weight of 388.82 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120609694 |
| Molecular Formula | C18H20ClF3N2O2 |
| Molecular Weight | 388.82 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 3-(2-aminophenyl)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]propanamide;hydrochloride |
| SMILES | Cc1ccc(NC(=O)CCc2ccccc2N)c(OCC(F)(F)F)c1.Cl |
| InChI | InChI=1S/C18H19F3N2O2.ClH/c1-12-6-8-15(16(10-12)25-11-18(19,20)21)23-17(24)9-7-13-4-2-3-5-14(13)22;/h2-6,8,10H,7,9,11,22H2,1H3,(H,23,24);1H |
| InChIKey | RGBUCNPNFLSAIM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.82 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|