C14H20ClF3N2O3 — CID 119746938
2-(2-methoxyethylamino)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]acetamide;hydrochloride (PubChem CID 119746938) has the molecular formula C14H20ClF3N2O3 and a molecular weight of 356.77 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119746938 |
| Molecular Formula | C14H20ClF3N2O3 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]acetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1ccc(C)cc1OCC(F)(F)F.Cl |
| InChI | InChI=1S/C14H19F3N2O3.ClH/c1-10-3-4-11(12(7-10)22-9-14(15,16)17)19-13(20)8-18-5-6-21-2;/h3-4,7,18H,5-6,8-9H2,1-2H3,(H,19,20);1H |
| InChIKey | SWLQNXBYDYMDFD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|