C13H17F3N2O2 — CID 119302270
4-amino-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]butanamide (PubChem CID 119302270) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.29 g/mol. Its IUPAC name is 4-amino-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]butanamide.
| Compound Name | 4-amino-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 119302270 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-amino-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]butanamide |
| SMILES | Cc1ccc(NC(=O)CCCN)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2O2/c1-9-4-5-10(18-12(19)3-2-6-17)11(7-9)20-8-13(14,15)16/h4-5,7H,2-3,6,8,17H2,1H3,(H,18,19) |
| InChIKey | ZCQFVTMKGWRTQG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |