C18H17F3N2O3 — CID 60575123
4-acetamido-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]benzamide (PubChem CID 60575123) has the molecular formula C18H17F3N2O3 and a molecular weight of 366.34 g/mol. Its IUPAC name is 4-acetamido-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]benzamide.
| Compound Name | 4-acetamido-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 60575123 |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-acetamido-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]benzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)Nc2ccc(C)cc2OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F3N2O3/c1-11-3-8-15(16(9-11)26-10-18(19,20)21)23-17(25)13-4-6-14(7-5-13)22-12(2)24/h3-9H,10H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | QZDDNMUZURHVNZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |