C21H25N3O4 — CID 170985606
tert-butyl N-[2-[(4-acetamidobenzoyl)amino]-5-methylphenyl]carbamate (PubChem CID 170985606) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-acetamidobenzoyl)amino]-5-methylphenyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-acetamidobenzoyl)amino]-5-methylphenyl]carbamate |
|---|---|
| PubChem CID | 170985606 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | tert-butyl N-[2-[(4-acetamidobenzoyl)amino]-5-methylphenyl]carbamate |
| SMILES | CC(=O)Nc1ccc(C(=O)Nc2ccc(C)cc2NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-13-6-11-17(18(12-13)24-20(27)28-21(3,4)5)23-19(26)15-7-9-16(10-8-15)22-14(2)25/h6-12H,1-5H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | HPAXLCKYHBJNGX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |