C18H19IN2O3 — CID 26245474
tert-butyl N-[4-[(3-iodophenyl)carbamoyl]phenyl]carbamate (PubChem CID 26245474) has the molecular formula C18H19IN2O3 and a molecular weight of 438.27 g/mol. Its IUPAC name is tert-butyl N-[4-[(3-iodophenyl)carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(3-iodophenyl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 26245474 |
| Molecular Formula | C18H19IN2O3 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | tert-butyl N-[4-[(3-iodophenyl)carbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)Nc2cccc(I)c2)cc1 |
| InChI | InChI=1S/C18H19IN2O3/c1-18(2,3)24-17(23)21-14-9-7-12(8-10-14)16(22)20-15-6-4-5-13(19)11-15/h4-11H,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | MNAHUEARPVJANS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|