C26H25N3O4 — CID 90102050
tert-butyl N-[4-[[3-(phenacylideneamino)phenyl]carbamoyl]phenyl]carbamate (PubChem CID 90102050) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is tert-butyl N-[4-[[3-(phenacylideneamino)phenyl]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[3-(phenacylideneamino)phenyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 90102050 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | tert-butyl N-[4-[[3-(phenacylideneamino)phenyl]carbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)Nc2cccc(/N=C/C(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C26H25N3O4/c1-26(2,3)33-25(32)29-20-14-12-19(13-15-20)24(31)28-22-11-7-10-21(16-22)27-17-23(30)18-8-5-4-6-9-18/h4-17H,1-3H3,(H,28,31)(H,29,32)/b27-17+ |
| InChIKey | YJKVHFJJFKXAKM-WPWMEQJKSA-N |
| XLogP | 5.87 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|