C23H24N4O3 — CID 166833071
tert-butyl N-[3-[[4-(pyridin-4-ylamino)phenyl]carbamoyl]phenyl]carbamate (PubChem CID 166833071) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-(pyridin-4-ylamino)phenyl]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-(pyridin-4-ylamino)phenyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 166833071 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | tert-butyl N-[3-[[4-(pyridin-4-ylamino)phenyl]carbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(C(=O)Nc2ccc(Nc3ccncc3)cc2)c1 |
| InChI | InChI=1S/C23H24N4O3/c1-23(2,3)30-22(29)27-20-6-4-5-16(15-20)21(28)26-18-9-7-17(8-10-18)25-19-11-13-24-14-12-19/h4-15H,1-3H3,(H,24,25)(H,26,28)(H,27,29) |
| InChIKey | DHITXHUGQXZROK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |