C20H20N4O3S — CID 55984007
tert-butyl N-[3-[[4-(thiadiazol-4-yl)phenyl]carbamoyl]phenyl]carbamate (PubChem CID 55984007) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-(thiadiazol-4-yl)phenyl]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-(thiadiazol-4-yl)phenyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 55984007 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | tert-butyl N-[3-[[4-(thiadiazol-4-yl)phenyl]carbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(C(=O)Nc2ccc(-c3csnn3)cc2)c1 |
| InChI | InChI=1S/C20H20N4O3S/c1-20(2,3)27-19(26)22-16-6-4-5-14(11-16)18(25)21-15-9-7-13(8-10-15)17-12-28-24-23-17/h4-12H,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | ITKIDWLRGAHESE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |