C23H23N3O4 — CID 157042654
tert-butyl N-[3-[(3-pyridin-4-yloxyphenyl)carbamoyl]phenyl]carbamate (PubChem CID 157042654) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is tert-butyl N-[3-[(3-pyridin-4-yloxyphenyl)carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(3-pyridin-4-yloxyphenyl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 157042654 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | tert-butyl N-[3-[(3-pyridin-4-yloxyphenyl)carbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(C(=O)Nc2cccc(Oc3ccncc3)c2)c1 |
| InChI | InChI=1S/C23H23N3O4/c1-23(2,3)30-22(28)26-17-7-4-6-16(14-17)21(27)25-18-8-5-9-20(15-18)29-19-10-12-24-13-11-19/h4-15H,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | AXHMRSJJRUKQFH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |