C20H16F2N2O2 — CID 58337430
3-(1,1-difluoroethyl)-N-(3-pyridin-3-yloxyphenyl)benzamide (PubChem CID 58337430) has the molecular formula C20H16F2N2O2 and a molecular weight of 354.36 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-N-(3-pyridin-3-yloxyphenyl)benzamide.
| Compound Name | 3-(1,1-difluoroethyl)-N-(3-pyridin-3-yloxyphenyl)benzamide |
|---|---|
| PubChem CID | 58337430 |
| Molecular Formula | C20H16F2N2O2 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-(1,1-difluoroethyl)-N-(3-pyridin-3-yloxyphenyl)benzamide |
| SMILES | CC(F)(F)c1cccc(C(=O)Nc2cccc(Oc3cccnc3)c2)c1 |
| InChI | InChI=1S/C20H16F2N2O2/c1-20(21,22)15-6-2-5-14(11-15)19(25)24-16-7-3-8-17(12-16)26-18-9-4-10-23-13-18/h2-13H,1H3,(H,24,25) |
| InChIKey | FMWVCNGHRAEIAW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |