C23H23ClN2O2 — CID 58615039
3-tert-butyl-N-[4-chloro-3-(pyridin-3-yloxymethyl)phenyl]benzamide (PubChem CID 58615039) has the molecular formula C23H23ClN2O2 and a molecular weight of 394.90 g/mol. Its IUPAC name is 3-tert-butyl-N-[4-chloro-3-(pyridin-3-yloxymethyl)phenyl]benzamide.
| Compound Name | 3-tert-butyl-N-[4-chloro-3-(pyridin-3-yloxymethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 58615039 |
| Molecular Formula | C23H23ClN2O2 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 3-tert-butyl-N-[4-chloro-3-(pyridin-3-yloxymethyl)phenyl]benzamide |
| SMILES | CC(C)(C)c1cccc(C(=O)Nc2ccc(Cl)c(COc3cccnc3)c2)c1 |
| InChI | InChI=1S/C23H23ClN2O2/c1-23(2,3)18-7-4-6-16(12-18)22(27)26-19-9-10-21(24)17(13-19)15-28-20-8-5-11-25-14-20/h4-14H,15H2,1-3H3,(H,26,27) |
| InChIKey | KCQGUNJEMZOUHE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |