C15H12F3N3O2 — CID 30348708
N-[3-(2,2,2-trifluoroethylcarbamoyl)phenyl]pyridine-3-carboxamide (PubChem CID 30348708) has the molecular formula C15H12F3N3O2 and a molecular weight of 323.27 g/mol. Its IUPAC name is N-[3-(2,2,2-trifluoroethylcarbamoyl)phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-(2,2,2-trifluoroethylcarbamoyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 30348708 |
| Molecular Formula | C15H12F3N3O2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[3-(2,2,2-trifluoroethylcarbamoyl)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1cccc(NC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C15H12F3N3O2/c16-15(17,18)9-20-13(22)10-3-1-5-12(7-10)21-14(23)11-4-2-6-19-8-11/h1-8H,9H2,(H,20,22)(H,21,23) |
| InChIKey | BGSFODKZXGPNNU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |