C21H23N3O4 — CID 120544310
1-[[[3-(pyridine-3-carbonylamino)benzoyl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 120544310) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-[[[3-(pyridine-3-carbonylamino)benzoyl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[[3-(pyridine-3-carbonylamino)benzoyl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120544310 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-[[[3-(pyridine-3-carbonylamino)benzoyl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CCCCC1)c1cccc(NC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C21H23N3O4/c25-18(23-14-21(20(27)28)9-2-1-3-10-21)15-6-4-8-17(12-15)24-19(26)16-7-5-11-22-13-16/h4-8,11-13H,1-3,9-10,14H2,(H,23,25)(H,24,26)(H,27,28) |
| InChIKey | CZBHLRLGZAXXIR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |