C19H26Cl2N4O2 — CID 119571882
N-[3-[3-(aminomethyl)pentan-3-ylcarbamoyl]phenyl]pyridine-3-carboxamide;dihydrochloride (PubChem CID 119571882) has the molecular formula C19H26Cl2N4O2 and a molecular weight of 413.35 g/mol. Its IUPAC name is N-[3-[3-(aminomethyl)pentan-3-ylcarbamoyl]phenyl]pyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-[3-[3-(aminomethyl)pentan-3-ylcarbamoyl]phenyl]pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119571882 |
| Molecular Formula | C19H26Cl2N4O2 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[3-[3-(aminomethyl)pentan-3-ylcarbamoyl]phenyl]pyridine-3-carboxamide;dihydrochloride |
| SMILES | CCC(CC)(CN)NC(=O)c1cccc(NC(=O)c2cccnc2)c1.Cl.Cl |
| InChI | InChI=1S/C19H24N4O2.2ClH/c1-3-19(4-2,13-20)23-18(25)14-7-5-9-16(11-14)22-17(24)15-8-6-10-21-12-15;;/h5-12H,3-4,13,20H2,1-2H3,(H,22,24)(H,23,25);2*1H |
| InChIKey | UUGHIUTXFZNNAI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |