C19H27Cl2N3O2 — CID 119569679
N-[3-(aminomethyl)pentan-3-yl]-3-(pyridin-3-ylmethoxy)benzamide;dihydrochloride (PubChem CID 119569679) has the molecular formula C19H27Cl2N3O2 and a molecular weight of 400.35 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-3-(pyridin-3-ylmethoxy)benzamide;dihydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-3-(pyridin-3-ylmethoxy)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119569679 |
| Molecular Formula | C19H27Cl2N3O2 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-3-(pyridin-3-ylmethoxy)benzamide;dihydrochloride |
| SMILES | CCC(CC)(CN)NC(=O)c1cccc(OCc2cccnc2)c1.Cl.Cl |
| InChI | InChI=1S/C19H25N3O2.2ClH/c1-3-19(4-2,14-20)22-18(23)16-8-5-9-17(11-16)24-13-15-7-6-10-21-12-15;;/h5-12H,3-4,13-14,20H2,1-2H3,(H,22,23);2*1H |
| InChIKey | JSFZSYAOCKLNGZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |