C23H27N3O4 — CID 55532756
tert-butyl N-[3-[[4-(pyrrolidine-1-carbonyl)phenyl]carbamoyl]phenyl]carbamate (PubChem CID 55532756) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-(pyrrolidine-1-carbonyl)phenyl]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-(pyrrolidine-1-carbonyl)phenyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 55532756 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | tert-butyl N-[3-[[4-(pyrrolidine-1-carbonyl)phenyl]carbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(C(=O)Nc2ccc(C(=O)N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C23H27N3O4/c1-23(2,3)30-22(29)25-19-8-6-7-17(15-19)20(27)24-18-11-9-16(10-12-18)21(28)26-13-4-5-14-26/h6-12,15H,4-5,13-14H2,1-3H3,(H,24,27)(H,25,29) |
| InChIKey | KBEFDLCRKCWUGE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |