C25H30N2O4 — CID 60552319
tert-butyl N-[3-[4-(4-methylbenzoyl)piperidine-1-carbonyl]phenyl]carbamate (PubChem CID 60552319) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(4-methylbenzoyl)piperidine-1-carbonyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(4-methylbenzoyl)piperidine-1-carbonyl]phenyl]carbamate |
|---|---|
| PubChem CID | 60552319 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | tert-butyl N-[3-[4-(4-methylbenzoyl)piperidine-1-carbonyl]phenyl]carbamate |
| SMILES | Cc1ccc(C(=O)C2CCN(C(=O)c3cccc(NC(=O)OC(C)(C)C)c3)CC2)cc1 |
| InChI | InChI=1S/C25H30N2O4/c1-17-8-10-18(11-9-17)22(28)19-12-14-27(15-13-19)23(29)20-6-5-7-21(16-20)26-24(30)31-25(2,3)4/h5-11,16,19H,12-15H2,1-4H3,(H,26,30) |
| InChIKey | USDSMMCYOCLPJC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |