C18H26N2O3 — CID 24537551
tert-butyl N-[3-(2-methylpiperidine-1-carbonyl)phenyl]carbamate (PubChem CID 24537551) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is tert-butyl N-[3-(2-methylpiperidine-1-carbonyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-methylpiperidine-1-carbonyl)phenyl]carbamate |
|---|---|
| PubChem CID | 24537551 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | tert-butyl N-[3-(2-methylpiperidine-1-carbonyl)phenyl]carbamate |
| SMILES | CC1CCCCN1C(=O)c1cccc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H26N2O3/c1-13-8-5-6-11-20(13)16(21)14-9-7-10-15(12-14)19-17(22)23-18(2,3)4/h7,9-10,12-13H,5-6,8,11H2,1-4H3,(H,19,22) |
| InChIKey | GXQHRZYVOZQNRE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |