C21H33N3O3 — CID 9473842
tert-butyl N-[3-[3-[(2S)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]carbamate (PubChem CID 9473842) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[(2S)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[(2S)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 9473842 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | tert-butyl N-[3-[3-[(2S)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]carbamate |
| SMILES | C[C@H]1CCCCN1CCCNC(=O)c1cccc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H33N3O3/c1-16-9-5-6-13-24(16)14-8-12-22-19(25)17-10-7-11-18(15-17)23-20(26)27-21(2,3)4/h7,10-11,15-16H,5-6,8-9,12-14H2,1-4H3,(H,22,25)(H,23,26)/t16-/m0/s1 |
| InChIKey | KKLOVBWXYQOIIX-INIZCTEOSA-N |
| XLogP | 4.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|