C20H27N5O2S — CID 92871048
5-methyl-N-[3-[3-[(2R)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 92871048) has the molecular formula C20H27N5O2S and a molecular weight of 401.54 g/mol. Its IUPAC name is 5-methyl-N-[3-[3-[(2R)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-methyl-N-[3-[3-[(2R)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 92871048 |
| Molecular Formula | C20H27N5O2S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 5-methyl-N-[3-[3-[(2R)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | Cc1nnc(C(=O)Nc2cccc(C(=O)NCCCN3CCCC[C@H]3C)c2)s1 |
| InChI | InChI=1S/C20H27N5O2S/c1-14-7-3-4-11-25(14)12-6-10-21-18(26)16-8-5-9-17(13-16)22-19(27)20-24-23-15(2)28-20/h5,8-9,13-14H,3-4,6-7,10-12H2,1-2H3,(H,21,26)(H,22,27)/t14-/m1/s1 |
| InChIKey | IEXIAUCNMPXZNB-CQSZACIVSA-N |
| XLogP | 3.09 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|