C20H25N5O2S — CID 46330081
5-cyclopropyl-N-[3-(3-pyrrolidin-1-ylpropylcarbamoyl)phenyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 46330081) has the molecular formula C20H25N5O2S and a molecular weight of 399.52 g/mol. Its IUPAC name is 5-cyclopropyl-N-[3-(3-pyrrolidin-1-ylpropylcarbamoyl)phenyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-cyclopropyl-N-[3-(3-pyrrolidin-1-ylpropylcarbamoyl)phenyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 46330081 |
| Molecular Formula | C20H25N5O2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 5-cyclopropyl-N-[3-(3-pyrrolidin-1-ylpropylcarbamoyl)phenyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(NCCCN1CCCC1)c1cccc(NC(=O)c2nnc(C3CC3)s2)c1 |
| InChI | InChI=1S/C20H25N5O2S/c26-17(21-9-4-12-25-10-1-2-11-25)15-5-3-6-16(13-15)22-18(27)20-24-23-19(28-20)14-7-8-14/h3,5-6,13-14H,1-2,4,7-12H2,(H,21,26)(H,22,27) |
| InChIKey | KEXXLYVSULALKW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|