C26H32N6O3S — CID 46332263
N-[3-[3-(4-ethylpiperazin-1-yl)propylcarbamoyl]phenyl]-5-(phenoxymethyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 46332263) has the molecular formula C26H32N6O3S and a molecular weight of 508.65 g/mol. Its IUPAC name is N-[3-[3-(4-ethylpiperazin-1-yl)propylcarbamoyl]phenyl]-5-(phenoxymethyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-[3-[3-(4-ethylpiperazin-1-yl)propylcarbamoyl]phenyl]-5-(phenoxymethyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 46332263 |
| Molecular Formula | C26H32N6O3S |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | N-[3-[3-(4-ethylpiperazin-1-yl)propylcarbamoyl]phenyl]-5-(phenoxymethyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)c2cccc(NC(=O)c3nnc(COc4ccccc4)s3)c2)CC1 |
| InChI | InChI=1S/C26H32N6O3S/c1-2-31-14-16-32(17-15-31)13-7-12-27-24(33)20-8-6-9-21(18-20)28-25(34)26-30-29-23(36-26)19-35-22-10-4-3-5-11-22/h3-6,8-11,18H,2,7,12-17,19H2,1H3,(H,27,33)(H,28,34) |
| InChIKey | DVUNVPJRQSNGPC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|