C26H23ClN4O3S — CID 46332189
5-[(4-chlorophenoxy)methyl]-N-[3-(3-phenylpropylcarbamoyl)phenyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 46332189) has the molecular formula C26H23ClN4O3S and a molecular weight of 507.02 g/mol. Its IUPAC name is 5-[(4-chlorophenoxy)methyl]-N-[3-(3-phenylpropylcarbamoyl)phenyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[(4-chlorophenoxy)methyl]-N-[3-(3-phenylpropylcarbamoyl)phenyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 46332189 |
| Molecular Formula | C26H23ClN4O3S |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 5-[(4-chlorophenoxy)methyl]-N-[3-(3-phenylpropylcarbamoyl)phenyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1cccc(NC(=O)c2nnc(COc3ccc(Cl)cc3)s2)c1 |
| InChI | InChI=1S/C26H23ClN4O3S/c27-20-11-13-22(14-12-20)34-17-23-30-31-26(35-23)25(33)29-21-10-4-9-19(16-21)24(32)28-15-5-8-18-6-2-1-3-7-18/h1-4,6-7,9-14,16H,5,8,15,17H2,(H,28,32)(H,29,33) |
| InChIKey | KQCIISWLEIFHFQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|