C21H21FN4O4S — CID 46332454
5-[(4-fluorophenoxy)methyl]-N-[3-(3-methoxypropylcarbamoyl)phenyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 46332454) has the molecular formula C21H21FN4O4S and a molecular weight of 444.49 g/mol. Its IUPAC name is 5-[(4-fluorophenoxy)methyl]-N-[3-(3-methoxypropylcarbamoyl)phenyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[(4-fluorophenoxy)methyl]-N-[3-(3-methoxypropylcarbamoyl)phenyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 46332454 |
| Molecular Formula | C21H21FN4O4S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 5-[(4-fluorophenoxy)methyl]-N-[3-(3-methoxypropylcarbamoyl)phenyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | COCCCNC(=O)c1cccc(NC(=O)c2nnc(COc3ccc(F)cc3)s2)c1 |
| InChI | InChI=1S/C21H21FN4O4S/c1-29-11-3-10-23-19(27)14-4-2-5-16(12-14)24-20(28)21-26-25-18(31-21)13-30-17-8-6-15(22)7-9-17/h2,4-9,12H,3,10-11,13H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | YEVOGVNXQOOZLC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|