C21H30N6O3S — CID 46332406
N-[3-[3-(4-ethylpiperazin-1-yl)propylcarbamoyl]phenyl]-5-(methoxymethyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 46332406) has the molecular formula C21H30N6O3S and a molecular weight of 446.58 g/mol. Its IUPAC name is N-[3-[3-(4-ethylpiperazin-1-yl)propylcarbamoyl]phenyl]-5-(methoxymethyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-[3-[3-(4-ethylpiperazin-1-yl)propylcarbamoyl]phenyl]-5-(methoxymethyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 46332406 |
| Molecular Formula | C21H30N6O3S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | N-[3-[3-(4-ethylpiperazin-1-yl)propylcarbamoyl]phenyl]-5-(methoxymethyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)c2cccc(NC(=O)c3nnc(COC)s3)c2)CC1 |
| InChI | InChI=1S/C21H30N6O3S/c1-3-26-10-12-27(13-11-26)9-5-8-22-19(28)16-6-4-7-17(14-16)23-20(29)21-25-24-18(31-21)15-30-2/h4,6-7,14H,3,5,8-13,15H2,1-2H3,(H,22,28)(H,23,29) |
| InChIKey | FKUMFCSLIQEZQK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|