C22H24N4O3S — CID 46332292
N-[3-(butylcarbamoyl)phenyl]-5-[(2-methylphenoxy)methyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 46332292) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is N-[3-(butylcarbamoyl)phenyl]-5-[(2-methylphenoxy)methyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-[3-(butylcarbamoyl)phenyl]-5-[(2-methylphenoxy)methyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 46332292 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[3-(butylcarbamoyl)phenyl]-5-[(2-methylphenoxy)methyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCCCNC(=O)c1cccc(NC(=O)c2nnc(COc3ccccc3C)s2)c1 |
| InChI | InChI=1S/C22H24N4O3S/c1-3-4-12-23-20(27)16-9-7-10-17(13-16)24-21(28)22-26-25-19(30-22)14-29-18-11-6-5-8-15(18)2/h5-11,13H,3-4,12,14H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | JYEKJRBGYHFORF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|