C22H29N5O2S — CID 92871107
5-cyclopropyl-N-[3-[3-[(3S)-3-methylpiperidin-1-yl]propylcarbamoyl]phenyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 92871107) has the molecular formula C22H29N5O2S and a molecular weight of 427.57 g/mol. Its IUPAC name is 5-cyclopropyl-N-[3-[3-[(3S)-3-methylpiperidin-1-yl]propylcarbamoyl]phenyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-cyclopropyl-N-[3-[3-[(3S)-3-methylpiperidin-1-yl]propylcarbamoyl]phenyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 92871107 |
| Molecular Formula | C22H29N5O2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 5-cyclopropyl-N-[3-[3-[(3S)-3-methylpiperidin-1-yl]propylcarbamoyl]phenyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | C[C@H]1CCCN(CCCNC(=O)c2cccc(NC(=O)c3nnc(C4CC4)s3)c2)C1 |
| InChI | InChI=1S/C22H29N5O2S/c1-15-5-3-11-27(14-15)12-4-10-23-19(28)17-6-2-7-18(13-17)24-20(29)22-26-25-21(30-22)16-8-9-16/h2,6-7,13,15-16H,3-5,8-12,14H2,1H3,(H,23,28)(H,24,29)/t15-/m0/s1 |
| InChIKey | JCTGMJVJIZMMBW-HNNXBMFYSA-N |
| XLogP | 3.52 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|