C16H22Cl2N2O — CID 9473209
3,4-dichloro-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide (PubChem CID 9473209) has the molecular formula C16H22Cl2N2O and a molecular weight of 329.27 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 9473209 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 3,4-dichloro-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide |
| SMILES | C[C@H]1CCCCN1CCCNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H22Cl2N2O/c1-12-5-2-3-9-20(12)10-4-8-19-16(21)13-6-7-14(17)15(18)11-13/h6-7,11-12H,2-5,8-10H2,1H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | PXQIQYNPAWDTCG-LBPRGKRZSA-N |
| XLogP | 3.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|