C23H33Cl2N3O2 — CID 60589630
1-(3,4-dichlorobenzoyl)-N-[4-(2-methylpiperidin-1-yl)butyl]piperidine-3-carboxamide (PubChem CID 60589630) has the molecular formula C23H33Cl2N3O2 and a molecular weight of 454.44 g/mol. Its IUPAC name is 1-(3,4-dichlorobenzoyl)-N-[4-(2-methylpiperidin-1-yl)butyl]piperidine-3-carboxamide.
| Compound Name | 1-(3,4-dichlorobenzoyl)-N-[4-(2-methylpiperidin-1-yl)butyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 60589630 |
| Molecular Formula | C23H33Cl2N3O2 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 1-(3,4-dichlorobenzoyl)-N-[4-(2-methylpiperidin-1-yl)butyl]piperidine-3-carboxamide |
| SMILES | CC1CCCCN1CCCCNC(=O)C1CCCN(C(=O)c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C23H33Cl2N3O2/c1-17-7-2-4-12-27(17)13-5-3-11-26-22(29)19-8-6-14-28(16-19)23(30)18-9-10-20(24)21(25)15-18/h9-10,15,17,19H,2-8,11-14,16H2,1H3,(H,26,29) |
| InChIKey | FGDNHRZJMIEIDV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|