C22H32FN3O2 — CID 39965506
1-(4-fluorobenzoyl)-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide (PubChem CID 39965506) has the molecular formula C22H32FN3O2 and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 39965506 |
| Molecular Formula | C22H32FN3O2 |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 1-(4-fluorobenzoyl)-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide |
| SMILES | C[C@H]1CCCCN1CCCNC(=O)C1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H32FN3O2/c1-17-5-2-3-13-25(17)14-4-12-24-21(27)18-10-15-26(16-11-18)22(28)19-6-8-20(23)9-7-19/h6-9,17-18H,2-5,10-16H2,1H3,(H,24,27)/t17-/m0/s1 |
| InChIKey | UDCUAHYMWSJVII-KRWDZBQOSA-N |
| XLogP | 3.06 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|