C21H29Cl2N3O2 — CID 55632873
N-[2-(azepan-1-yl)ethyl]-1-(3,4-dichlorobenzoyl)piperidine-3-carboxamide (PubChem CID 55632873) has the molecular formula C21H29Cl2N3O2 and a molecular weight of 426.39 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)ethyl]-1-(3,4-dichlorobenzoyl)piperidine-3-carboxamide.
| Compound Name | N-[2-(azepan-1-yl)ethyl]-1-(3,4-dichlorobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55632873 |
| Molecular Formula | C21H29Cl2N3O2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[2-(azepan-1-yl)ethyl]-1-(3,4-dichlorobenzoyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCN1CCCCCC1)C1CCCN(C(=O)c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C21H29Cl2N3O2/c22-18-8-7-16(14-19(18)23)21(28)26-12-5-6-17(15-26)20(27)24-9-13-25-10-3-1-2-4-11-25/h7-8,14,17H,1-6,9-13,15H2,(H,24,27) |
| InChIKey | PNUDICLOSBXLFW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |