C16H22ClN3O2 — CID 119480976
N-(2-aminoethyl)-1-(3-chloro-4-methylbenzoyl)piperidine-3-carboxamide (PubChem CID 119480976) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(3-chloro-4-methylbenzoyl)piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(3-chloro-4-methylbenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119480976 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-(2-aminoethyl)-1-(3-chloro-4-methylbenzoyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)N2CCCC(C(=O)NCCN)C2)cc1Cl |
| InChI | InChI=1S/C16H22ClN3O2/c1-11-4-5-12(9-14(11)17)16(22)20-8-2-3-13(10-20)15(21)19-7-6-18/h4-5,9,13H,2-3,6-8,10,18H2,1H3,(H,19,21) |
| InChIKey | NQBBPZRTMOXAPV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |