C17H25N3O2 — CID 119480898
N-(2-aminoethyl)-1-(2,4-dimethylbenzoyl)piperidine-3-carboxamide (PubChem CID 119480898) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(2,4-dimethylbenzoyl)piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(2,4-dimethylbenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119480898 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-(2-aminoethyl)-1-(2,4-dimethylbenzoyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)N2CCCC(C(=O)NCCN)C2)c(C)c1 |
| InChI | InChI=1S/C17H25N3O2/c1-12-5-6-15(13(2)10-12)17(22)20-9-3-4-14(11-20)16(21)19-8-7-18/h5-6,10,14H,3-4,7-9,11,18H2,1-2H3,(H,19,21) |
| InChIKey | NCTCYGJYFPNLSE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |