C16H22N4O4 — CID 119480572
N-(2-aminoethyl)-1-(5-methyl-2-nitrobenzoyl)piperidine-3-carboxamide (PubChem CID 119480572) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(5-methyl-2-nitrobenzoyl)piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(5-methyl-2-nitrobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119480572 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | N-(2-aminoethyl)-1-(5-methyl-2-nitrobenzoyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])c(C(=O)N2CCCC(C(=O)NCCN)C2)c1 |
| InChI | InChI=1S/C16H22N4O4/c1-11-4-5-14(20(23)24)13(9-11)16(22)19-8-2-3-12(10-19)15(21)18-7-6-17/h4-5,9,12H,2-3,6-8,10,17H2,1H3,(H,18,21) |
| InChIKey | PYKDGBZPFREMTL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|