C21H28ClFN4O2 — CID 119481306
N-(2-aminoethyl)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperidine-3-carboxamide;hydrochloride (PubChem CID 119481306) has the molecular formula C21H28ClFN4O2 and a molecular weight of 422.93 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119481306 |
| Molecular Formula | C21H28ClFN4O2 |
| Molecular Weight | 422.93 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | N-(2-aminoethyl)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperidine-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(C(=O)N2CCCC(C(=O)NCCN)C2)c(C)n1-c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C21H27FN4O2.ClH/c1-14-12-19(15(2)26(14)18-7-5-17(22)6-8-18)21(28)25-11-3-4-16(13-25)20(27)24-10-9-23;/h5-8,12,16H,3-4,9-11,13,23H2,1-2H3,(H,24,27);1H |
| InChIKey | JAVVYERSPJTAJN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.93 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|