C19H24FN3O — CID 119541051
[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone (PubChem CID 119541051) has the molecular formula C19H24FN3O and a molecular weight of 329.42 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 119541051 |
| Molecular Formula | C19H24FN3O |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | [1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone |
| SMILES | CNCC1CCN(C(=O)c2cc(C)n(-c3ccc(F)cc3)c2C)C1 |
| InChI | InChI=1S/C19H24FN3O/c1-13-10-18(19(24)22-9-8-15(12-22)11-21-3)14(2)23(13)17-6-4-16(20)5-7-17/h4-7,10,15,21H,8-9,11-12H2,1-3H3 |
| InChIKey | IMAPAABSMOPJRU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|