C22H31N3O — CID 119541142
[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone (PubChem CID 119541142) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is [2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 119541142 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | [2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone |
| SMILES | CNCC1CCN(C(=O)c2cc(C)n(-c3ccc(C(C)C)cc3)c2C)C1 |
| InChI | InChI=1S/C22H31N3O/c1-15(2)19-6-8-20(9-7-19)25-16(3)12-21(17(25)4)22(26)24-11-10-18(14-24)13-23-5/h6-9,12,15,18,23H,10-11,13-14H2,1-5H3 |
| InChIKey | FJSVIXROSRWPGU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|