C15H18F3N3O2 — CID 119480903
N-(2-aminoethyl)-1-(2,4,6-trifluorobenzoyl)piperidine-3-carboxamide (PubChem CID 119480903) has the molecular formula C15H18F3N3O2 and a molecular weight of 329.32 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(2,4,6-trifluorobenzoyl)piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(2,4,6-trifluorobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119480903 |
| Molecular Formula | C15H18F3N3O2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-(2-aminoethyl)-1-(2,4,6-trifluorobenzoyl)piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(C(=O)c2c(F)cc(F)cc2F)C1 |
| InChI | InChI=1S/C15H18F3N3O2/c16-10-6-11(17)13(12(18)7-10)15(23)21-5-1-2-9(8-21)14(22)20-4-3-19/h6-7,9H,1-5,8,19H2,(H,20,22) |
| InChIKey | JOHFYXMOERSHLO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |