C13H18BrN3O3 — CID 119480250
N-(2-aminoethyl)-1-(5-bromofuran-3-carbonyl)piperidine-3-carboxamide (PubChem CID 119480250) has the molecular formula C13H18BrN3O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(5-bromofuran-3-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(5-bromofuran-3-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119480250 |
| Molecular Formula | C13H18BrN3O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | N-(2-aminoethyl)-1-(5-bromofuran-3-carbonyl)piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(C(=O)c2coc(Br)c2)C1 |
| InChI | InChI=1S/C13H18BrN3O3/c14-11-6-10(8-20-11)13(19)17-5-1-2-9(7-17)12(18)16-4-3-15/h6,8-9H,1-5,7,15H2,(H,16,18) |
| InChIKey | BVFLKAVHZGNPHO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |