C15H22ClN5O4 — CID 119482085
N-(2-aminoethyl)-1-(4-amino-3-nitrobenzoyl)piperidine-3-carboxamide;hydrochloride (PubChem CID 119482085) has the molecular formula C15H22ClN5O4 and a molecular weight of 371.83 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(4-amino-3-nitrobenzoyl)piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-1-(4-amino-3-nitrobenzoyl)piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119482085 |
| Molecular Formula | C15H22ClN5O4 |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-(2-aminoethyl)-1-(4-amino-3-nitrobenzoyl)piperidine-3-carboxamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)C1CCCN(C(=O)c2ccc(N)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C15H21N5O4.ClH/c16-5-6-18-14(21)11-2-1-7-19(9-11)15(22)10-3-4-12(17)13(8-10)20(23)24;/h3-4,8,11H,1-2,5-7,9,16-17H2,(H,18,21);1H |
| InChIKey | YLDXHXPNTOLDBL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 144.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|