C16H21ClN6O4 — CID 119479853
N-(2-aminoethyl)-1-(5-nitro-1H-indazole-3-carbonyl)piperidine-3-carboxamide;hydrochloride (PubChem CID 119479853) has the molecular formula C16H21ClN6O4 and a molecular weight of 396.84 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(5-nitro-1H-indazole-3-carbonyl)piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-1-(5-nitro-1H-indazole-3-carbonyl)piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119479853 |
| Molecular Formula | C16H21ClN6O4 |
| Molecular Weight | 396.84 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-(2-aminoethyl)-1-(5-nitro-1H-indazole-3-carbonyl)piperidine-3-carboxamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)C1CCCN(C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)C1 |
| InChI | InChI=1S/C16H20N6O4.ClH/c17-5-6-18-15(23)10-2-1-7-21(9-10)16(24)14-12-8-11(22(25)26)3-4-13(12)19-20-14;/h3-4,8,10H,1-2,5-7,9,17H2,(H,18,23)(H,19,20);1H |
| InChIKey | LCIJFNMIHXRUFJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 147.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.84 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|