C18H23ClN6O4 — CID 119481071
N-(2-aminoethyl)-1-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperidine-3-carboxamide;hydrochloride (PubChem CID 119481071) has the molecular formula C18H23ClN6O4 and a molecular weight of 422.87 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-1-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119481071 |
| Molecular Formula | C18H23ClN6O4 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N-(2-aminoethyl)-1-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperidine-3-carboxamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)C1CCCN(C(=O)c2ccn(-c3cccc([N+](=O)[O-])c3)n2)C1 |
| InChI | InChI=1S/C18H22N6O4.ClH/c19-7-8-20-17(25)13-3-2-9-22(12-13)18(26)16-6-10-23(21-16)14-4-1-5-15(11-14)24(27)28;/h1,4-6,10-11,13H,2-3,7-9,12,19H2,(H,20,25);1H |
| InChIKey | MELYRZOTUYGGHA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|