C14H15N5O3 — CID 119411732
[(3R)-3-aminopyrrolidin-1-yl]-[1-(3-nitrophenyl)pyrazol-3-yl]methanone (PubChem CID 119411732) has the molecular formula C14H15N5O3 and a molecular weight of 301.31 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-[1-(3-nitrophenyl)pyrazol-3-yl]methanone.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-[1-(3-nitrophenyl)pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 119411732 |
| Molecular Formula | C14H15N5O3 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-[1-(3-nitrophenyl)pyrazol-3-yl]methanone |
| SMILES | N[C@@H]1CCN(C(=O)c2ccn(-c3cccc([N+](=O)[O-])c3)n2)C1 |
| InChI | InChI=1S/C14H15N5O3/c15-10-4-6-17(9-10)14(20)13-5-7-18(16-13)11-2-1-3-12(8-11)19(21)22/h1-3,5,7-8,10H,4,6,9,15H2/t10-/m1/s1 |
| InChIKey | YYPYRVMJTPVUII-SNVBAGLBSA-N |
| XLogP | 0.95 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|