C20H18ClN5O5S — CID 39928572
[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-[1-(3-nitrophenyl)pyrazol-3-yl]methanone (PubChem CID 39928572) has the molecular formula C20H18ClN5O5S and a molecular weight of 475.91 g/mol. Its IUPAC name is [4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-[1-(3-nitrophenyl)pyrazol-3-yl]methanone.
| Compound Name | [4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-[1-(3-nitrophenyl)pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 39928572 |
| Molecular Formula | C20H18ClN5O5S |
| Molecular Weight | 475.91 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | [4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-[1-(3-nitrophenyl)pyrazol-3-yl]methanone |
| SMILES | O=C(c1ccn(-c2cccc([N+](=O)[O-])c2)n1)N1CCN(S(=O)(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H18ClN5O5S/c21-17-6-1-2-7-19(17)32(30,31)24-12-10-23(11-13-24)20(27)18-8-9-25(22-18)15-4-3-5-16(14-15)26(28)29/h1-9,14H,10-13H2 |
| InChIKey | CVUCIEPEMXUNFJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 118.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.91 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|