C23H22ClN5O5 — CID 55677913
methyl 2-(2-chlorophenyl)-2-[4-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperazin-1-yl]acetate (PubChem CID 55677913) has the molecular formula C23H22ClN5O5 and a molecular weight of 483.91 g/mol. Its IUPAC name is methyl 2-(2-chlorophenyl)-2-[4-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperazin-1-yl]acetate.
| Compound Name | methyl 2-(2-chlorophenyl)-2-[4-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 55677913 |
| Molecular Formula | C23H22ClN5O5 |
| Molecular Weight | 483.91 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | methyl 2-(2-chlorophenyl)-2-[4-[1-(3-nitrophenyl)pyrazole-3-carbonyl]piperazin-1-yl]acetate |
| SMILES | COC(=O)C(c1ccccc1Cl)N1CCN(C(=O)c2ccn(-c3cccc([N+](=O)[O-])c3)n2)CC1 |
| InChI | InChI=1S/C23H22ClN5O5/c1-34-23(31)21(18-7-2-3-8-19(18)24)26-11-13-27(14-12-26)22(30)20-9-10-28(25-20)16-5-4-6-17(15-16)29(32)33/h2-10,15,21H,11-14H2,1H3 |
| InChIKey | OOQWLPKWDYDHMJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 110.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.91 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|