C23H23ClN4O3S — CID 55491513
methyl 2-(2-chlorophenyl)-2-[4-(3-phenyl-2-sulfanylidene-1H-imidazole-4-carbonyl)piperazin-1-yl]acetate (PubChem CID 55491513) has the molecular formula C23H23ClN4O3S and a molecular weight of 470.98 g/mol. Its IUPAC name is methyl 2-(2-chlorophenyl)-2-[4-(3-phenyl-2-sulfanylidene-1H-imidazole-4-carbonyl)piperazin-1-yl]acetate.
| Compound Name | methyl 2-(2-chlorophenyl)-2-[4-(3-phenyl-2-sulfanylidene-1H-imidazole-4-carbonyl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 55491513 |
| Molecular Formula | C23H23ClN4O3S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | methyl 2-(2-chlorophenyl)-2-[4-(3-phenyl-2-sulfanylidene-1H-imidazole-4-carbonyl)piperazin-1-yl]acetate |
| SMILES | COC(=O)C(c1ccccc1Cl)N1CCN(C(=O)c2c[nH]c(=S)n2-c2ccccc2)CC1 |
| InChI | InChI=1S/C23H23ClN4O3S/c1-31-22(30)20(17-9-5-6-10-18(17)24)26-11-13-27(14-12-26)21(29)19-15-25-23(32)28(19)16-7-3-2-4-8-16/h2-10,15,20H,11-14H2,1H3,(H,25,32) |
| InChIKey | GLUFXOFXCFQDFH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|