C23H27ClN2O5 — CID 46553316
methyl 2-(2-chlorophenyl)-2-[4-(3-ethoxy-4-methoxybenzoyl)piperazin-1-yl]acetate (PubChem CID 46553316) has the molecular formula C23H27ClN2O5 and a molecular weight of 446.93 g/mol. Its IUPAC name is methyl 2-(2-chlorophenyl)-2-[4-(3-ethoxy-4-methoxybenzoyl)piperazin-1-yl]acetate.
| Compound Name | methyl 2-(2-chlorophenyl)-2-[4-(3-ethoxy-4-methoxybenzoyl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 46553316 |
| Molecular Formula | C23H27ClN2O5 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | methyl 2-(2-chlorophenyl)-2-[4-(3-ethoxy-4-methoxybenzoyl)piperazin-1-yl]acetate |
| SMILES | CCOc1cc(C(=O)N2CCN(C(C(=O)OC)c3ccccc3Cl)CC2)ccc1OC |
| InChI | InChI=1S/C23H27ClN2O5/c1-4-31-20-15-16(9-10-19(20)29-2)22(27)26-13-11-25(12-14-26)21(23(28)30-3)17-7-5-6-8-18(17)24/h5-10,15,21H,4,11-14H2,1-3H3 |
| InChIKey | UYWDHPVJKQPYFO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |