C24H29ClN2O5 — CID 51644690
ethyl (2R)-2-(4-chlorophenyl)-2-[4-(4-ethoxy-3-methoxybenzoyl)piperazin-1-yl]acetate (PubChem CID 51644690) has the molecular formula C24H29ClN2O5 and a molecular weight of 460.96 g/mol. Its IUPAC name is ethyl (2R)-2-(4-chlorophenyl)-2-[4-(4-ethoxy-3-methoxybenzoyl)piperazin-1-yl]acetate.
| Compound Name | ethyl (2R)-2-(4-chlorophenyl)-2-[4-(4-ethoxy-3-methoxybenzoyl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 51644690 |
| Molecular Formula | C24H29ClN2O5 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | ethyl (2R)-2-(4-chlorophenyl)-2-[4-(4-ethoxy-3-methoxybenzoyl)piperazin-1-yl]acetate |
| SMILES | CCOC(=O)[C@@H](c1ccc(Cl)cc1)N1CCN(C(=O)c2ccc(OCC)c(OC)c2)CC1 |
| InChI | InChI=1S/C24H29ClN2O5/c1-4-31-20-11-8-18(16-21(20)30-3)23(28)27-14-12-26(13-15-27)22(24(29)32-5-2)17-6-9-19(25)10-7-17/h6-11,16,22H,4-5,12-15H2,1-3H3/t22-/m1/s1 |
| InChIKey | YYIMFXMEVDDYMK-JOCHJYFZSA-N |
| XLogP | 3.81 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |