C25H27ClN4O3 — CID 24560570
ethyl 2-[4-(1-benzylpyrazole-4-carbonyl)piperazin-1-yl]-2-(4-chlorophenyl)acetate (PubChem CID 24560570) has the molecular formula C25H27ClN4O3 and a molecular weight of 466.97 g/mol. Its IUPAC name is ethyl 2-[4-(1-benzylpyrazole-4-carbonyl)piperazin-1-yl]-2-(4-chlorophenyl)acetate.
| Compound Name | ethyl 2-[4-(1-benzylpyrazole-4-carbonyl)piperazin-1-yl]-2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 24560570 |
| Molecular Formula | C25H27ClN4O3 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | ethyl 2-[4-(1-benzylpyrazole-4-carbonyl)piperazin-1-yl]-2-(4-chlorophenyl)acetate |
| SMILES | CCOC(=O)C(c1ccc(Cl)cc1)N1CCN(C(=O)c2cnn(Cc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C25H27ClN4O3/c1-2-33-25(32)23(20-8-10-22(26)11-9-20)28-12-14-29(15-13-28)24(31)21-16-27-30(18-21)17-19-6-4-3-5-7-19/h3-11,16,18,23H,2,12-15,17H2,1H3 |
| InChIKey | XVLOKXLYZWENJN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |